C29H31Br3N2O7S — CID 175867245
4-methylbenzenesulfonic acid;2,2,2-tribromoethyl 2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propyl]amino]acetate (PubChem CID 175867245) has the molecular formula C29H31Br3N2O7S and a molecular weight of 791.35 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;2,2,2-tribromoethyl 2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propyl]amino]acetate.
| Compound Name | 4-methylbenzenesulfonic acid;2,2,2-tribromoethyl 2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propyl]amino]acetate |
|---|---|
| PubChem CID | 175867245 |
| Molecular Formula | C29H31Br3N2O7S |
| Molecular Weight | 791.35 g/mol |
| Exact Mass | 787.94 |
| IUPAC Name | 4-methylbenzenesulfonic acid;2,2,2-tribromoethyl 2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propyl]amino]acetate |
| SMILES | C[C@@H](CNCC(=O)OCC(Br)(Br)Br)NC(=O)OCC1c2ccccc2-c2ccccc21.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C22H23Br3N2O4.C7H8O3S/c1-14(10-26-11-20(28)31-13-22(23,24)25)27-21(29)30-12-19-17-8-4-2-6-15(17)16-7-3-5-9-18(16)19;1-6-2-4-7(5-3-6)11(8,9)10/h2-9,14,19,26H,10-13H2,1H3,(H,27,29);2-5H,1H3,(H,8,9,10)/t14-;/m0./s1 |
| InChIKey | BAKPEYCAJVVJOT-UQKRIMTDSA-N |
| XLogP | 6.13 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.35 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|