C32H36N2O6S — CID 23385770
2-[cyclopropylmethyl-(4-methylphenyl)sulfonylamino]-6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (PubChem CID 23385770) has the molecular formula C32H36N2O6S and a molecular weight of 576.72 g/mol. Its IUPAC name is 2-[cyclopropylmethyl-(4-methylphenyl)sulfonylamino]-6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid.
| Compound Name | 2-[cyclopropylmethyl-(4-methylphenyl)sulfonylamino]-6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 23385770 |
| Molecular Formula | C32H36N2O6S |
| Molecular Weight | 576.72 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | 2-[cyclopropylmethyl-(4-methylphenyl)sulfonylamino]-6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N(CC2CC2)C(CCCCNC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)cc1 |
| InChI | InChI=1S/C32H36N2O6S/c1-22-13-17-24(18-14-22)41(38,39)34(20-23-15-16-23)30(31(35)36)12-6-7-19-33-32(37)40-21-29-27-10-4-2-8-25(27)26-9-3-5-11-28(26)29/h2-5,8-11,13-14,17-18,23,29-30H,6-7,12,15-16,19-21H2,1H3,(H,33,37)(H,35,36) |
| InChIKey | BZXPRPQYBKHJGU-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.72 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|