C11H15NO2S — CID 175911040
2-ethoxy-1-(1,3-thiazol-2-yl)hex-1-en-3-one (PubChem CID 175911040) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is 2-ethoxy-1-(1,3-thiazol-2-yl)hex-1-en-3-one.
| Compound Name | 2-ethoxy-1-(1,3-thiazol-2-yl)hex-1-en-3-one |
|---|---|
| PubChem CID | 175911040 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 2-ethoxy-1-(1,3-thiazol-2-yl)hex-1-en-3-one |
| SMILES | CCCC(=O)C(=Cc1nccs1)OCC |
| InChI | InChI=1S/C11H15NO2S/c1-3-5-9(13)10(14-4-2)8-11-12-6-7-15-11/h6-8H,3-5H2,1-2H3 |
| InChIKey | VOYLPEMRYZLTRJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|