C8H11NOS — CID 63199328
1-(1,3-thiazol-2-yl)pentan-2-one (PubChem CID 63199328) has the molecular formula C8H11NOS and a molecular weight of 169.25 g/mol. Its IUPAC name is 1-(1,3-thiazol-2-yl)pentan-2-one.
| Compound Name | 1-(1,3-thiazol-2-yl)pentan-2-one |
|---|---|
| PubChem CID | 63199328 |
| Molecular Formula | C8H11NOS |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 1-(1,3-thiazol-2-yl)pentan-2-one |
| SMILES | CCCC(=O)Cc1nccs1 |
| InChI | InChI=1S/C8H11NOS/c1-2-3-7(10)6-8-9-4-5-11-8/h4-5H,2-3,6H2,1H3 |
| InChIKey | MAAFITCVXNOKRG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |