C15H17NOS — CID 157253743
1-(4-propan-2-ylphenyl)-3-(1,3-thiazol-2-yl)propan-2-one (PubChem CID 157253743) has the molecular formula C15H17NOS and a molecular weight of 259.37 g/mol. Its IUPAC name is 1-(4-propan-2-ylphenyl)-3-(1,3-thiazol-2-yl)propan-2-one.
| Compound Name | 1-(4-propan-2-ylphenyl)-3-(1,3-thiazol-2-yl)propan-2-one |
|---|---|
| PubChem CID | 157253743 |
| Molecular Formula | C15H17NOS |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 1-(4-propan-2-ylphenyl)-3-(1,3-thiazol-2-yl)propan-2-one |
| SMILES | CC(C)c1ccc(CC(=O)Cc2nccs2)cc1 |
| InChI | InChI=1S/C15H17NOS/c1-11(2)13-5-3-12(4-6-13)9-14(17)10-15-16-7-8-18-15/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | AWQFUMGBZVXQLJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |