C12H17NO2S — CID 58474334
6,6-dimethyl-1-(1,3-thiazol-2-yl)heptane-2,4-dione (PubChem CID 58474334) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is 6,6-dimethyl-1-(1,3-thiazol-2-yl)heptane-2,4-dione.
| Compound Name | 6,6-dimethyl-1-(1,3-thiazol-2-yl)heptane-2,4-dione |
|---|---|
| PubChem CID | 58474334 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 6,6-dimethyl-1-(1,3-thiazol-2-yl)heptane-2,4-dione |
| SMILES | CC(C)(C)CC(=O)CC(=O)Cc1nccs1 |
| InChI | InChI=1S/C12H17NO2S/c1-12(2,3)8-10(15)6-9(14)7-11-13-4-5-16-11/h4-5H,6-8H2,1-3H3 |
| InChIKey | ZZCOFWYADRZBMU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|