C6H9N3O2S — CID 175372903
ethyl N-amino-N-(1,3-thiazol-2-yl)carbamate (PubChem CID 175372903) has the molecular formula C6H9N3O2S and a molecular weight of 187.22 g/mol. Its IUPAC name is ethyl N-amino-N-(1,3-thiazol-2-yl)carbamate.
| Compound Name | ethyl N-amino-N-(1,3-thiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 175372903 |
| Molecular Formula | C6H9N3O2S |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | ethyl N-amino-N-(1,3-thiazol-2-yl)carbamate |
| SMILES | CCOC(=O)N(N)c1nccs1 |
| InChI | InChI=1S/C6H9N3O2S/c1-2-11-6(10)9(7)5-8-3-4-12-5/h3-4H,2,7H2,1H3 |
| InChIKey | LYUKQQFJOSLOBZ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|