C10H11N3O3S2 — CID 159602190
ethyl 1,3-thiazole-2-carboxylate;1,3-thiazole-2-carboxamide (PubChem CID 159602190) has the molecular formula C10H11N3O3S2 and a molecular weight of 285.35 g/mol. Its IUPAC name is ethyl 1,3-thiazole-2-carboxylate;1,3-thiazole-2-carboxamide.
| Compound Name | ethyl 1,3-thiazole-2-carboxylate;1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 159602190 |
| Molecular Formula | C10H11N3O3S2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | ethyl 1,3-thiazole-2-carboxylate;1,3-thiazole-2-carboxamide |
| SMILES | CCOC(=O)c1nccs1.NC(=O)c1nccs1 |
| InChI | InChI=1S/C6H7NO2S.C4H4N2OS/c1-2-9-6(8)5-7-3-4-10-5;5-3(7)4-6-1-2-8-4/h3-4H,2H2,1H3;1-2H,(H2,5,7) |
| InChIKey | MLPUFXYPOGPDKG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |