C13H10N2O7S — CID 135911664
ethyl 4,5-dihydroxy-3-nitro-2-(1,3-thiazole-2-carbonyl)benzoate (PubChem CID 135911664) has the molecular formula C13H10N2O7S and a molecular weight of 338.30 g/mol. Its IUPAC name is ethyl 4,5-dihydroxy-3-nitro-2-(1,3-thiazole-2-carbonyl)benzoate.
| Compound Name | ethyl 4,5-dihydroxy-3-nitro-2-(1,3-thiazole-2-carbonyl)benzoate |
|---|---|
| PubChem CID | 135911664 |
| Molecular Formula | C13H10N2O7S |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | ethyl 4,5-dihydroxy-3-nitro-2-(1,3-thiazole-2-carbonyl)benzoate |
| SMILES | CCOC(=O)c1cc(O)c(O)c([N+](=O)[O-])c1C(=O)c1nccs1 |
| InChI | InChI=1S/C13H10N2O7S/c1-2-22-13(19)6-5-7(16)10(17)9(15(20)21)8(6)11(18)12-14-3-4-23-12/h3-5,16-17H,2H2,1H3 |
| InChIKey | MIAKOJATVPVQSJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 139.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|