C16H14N2O10 — CID 58345496
ethyl 5-ethoxycarbonyloxy-4-hydroxy-3-nitro-2-(1,2-oxazole-5-carbonyl)benzoate (PubChem CID 58345496) has the molecular formula C16H14N2O10 and a molecular weight of 394.29 g/mol. Its IUPAC name is ethyl 5-ethoxycarbonyloxy-4-hydroxy-3-nitro-2-(1,2-oxazole-5-carbonyl)benzoate.
| Compound Name | ethyl 5-ethoxycarbonyloxy-4-hydroxy-3-nitro-2-(1,2-oxazole-5-carbonyl)benzoate |
|---|---|
| PubChem CID | 58345496 |
| Molecular Formula | C16H14N2O10 |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | ethyl 5-ethoxycarbonyloxy-4-hydroxy-3-nitro-2-(1,2-oxazole-5-carbonyl)benzoate |
| SMILES | CCOC(=O)Oc1cc(C(=O)OCC)c(C(=O)c2ccno2)c([N+](=O)[O-])c1O |
| InChI | InChI=1S/C16H14N2O10/c1-3-25-15(21)8-7-10(27-16(22)26-4-2)14(20)12(18(23)24)11(8)13(19)9-5-6-17-28-9/h5-7,20H,3-4H2,1-2H3 |
| InChIKey | ZTPKGRCLAKVSIO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 168.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|