C14H13NO6 — CID 58345538
ethyl 4-hydroxy-5-methoxy-2-(1,2-oxazole-5-carbonyl)benzoate (PubChem CID 58345538) has the molecular formula C14H13NO6 and a molecular weight of 291.26 g/mol. Its IUPAC name is ethyl 4-hydroxy-5-methoxy-2-(1,2-oxazole-5-carbonyl)benzoate.
| Compound Name | ethyl 4-hydroxy-5-methoxy-2-(1,2-oxazole-5-carbonyl)benzoate |
|---|---|
| PubChem CID | 58345538 |
| Molecular Formula | C14H13NO6 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | ethyl 4-hydroxy-5-methoxy-2-(1,2-oxazole-5-carbonyl)benzoate |
| SMILES | CCOC(=O)c1cc(OC)c(O)cc1C(=O)c1ccno1 |
| InChI | InChI=1S/C14H13NO6/c1-3-20-14(18)9-7-12(19-2)10(16)6-8(9)13(17)11-4-5-15-21-11/h4-7,16H,3H2,1-2H3 |
| InChIKey | MTMQQVPCEHCBQK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 98.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |