C7H7N3O2S — CID 161463999
1,3-oxazole;1,3-thiazole-2-carboxamide (PubChem CID 161463999) has the molecular formula C7H7N3O2S and a molecular weight of 197.22 g/mol. Its IUPAC name is 1,3-oxazole;1,3-thiazole-2-carboxamide.
| Compound Name | 1,3-oxazole;1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 161463999 |
| Molecular Formula | C7H7N3O2S |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | 1,3-oxazole;1,3-thiazole-2-carboxamide |
| SMILES | NC(=O)c1nccs1.c1cocn1 |
| InChI | InChI=1S/C4H4N2OS.C3H3NO/c5-3(7)4-6-1-2-8-4;1-2-5-3-4-1/h1-2H,(H2,5,7);1-3H |
| InChIKey | WCEMBBFHSMWKHE-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |