About (Z)-but-2-enedioic acid;1,3-oxazole
(Z)-but-2-enedioic acid;1,3-oxazole (PubChem CID 174408863) has the molecular formula C7H7NO5
and a molecular weight of 185.13 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1,3-oxazole.
Molecular Properties
| Compound Name | (Z)-but-2-enedioic acid;1,3-oxazole |
| PubChem CID | 174408863 |
| Molecular Formula | C7H7NO5 |
| Molecular Weight | 185.13 g/mol |
| Exact Mass | 185.03 |
| IUPAC Name | (Z)-but-2-enedioic acid;1,3-oxazole |
| SMILES | O=C(O)/C=C\C(=O)O.c1cocn1 |
| InChI | InChI=1S/C4H4O4.C3H3NO/c5-3(6)1-2-4(7)8;1-2-5-3-4-1/h1-2H,(H,5,6)(H,7,8);1-3H/b2-1-; |
| InChIKey | LSRTWONXKNYSBS-ODZAUARKSA-N |
| XLogP | 0.39 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.13 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-enedioic acid;1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-enedioic acid;1,3-oxazole?
The IUPAC name of (Z)-but-2-enedioic acid;1,3-oxazole (CID 174408863) is (Z)-but-2-enedioic acid;1,3-oxazole.
What is the SMILES notation for (Z)-but-2-enedioic acid;1,3-oxazole?
The canonical SMILES for (Z)-but-2-enedioic acid;1,3-oxazole is O=C(O)/C=C\C(=O)O.c1cocn1.
What is the InChIKey of (Z)-but-2-enedioic acid;1,3-oxazole?
The InChIKey is LSRTWONXKNYSBS-ODZAUARKSA-N. The full InChI is InChI=1S/C4H4O4.C3H3NO/c5-3(6)1-2-4(7)8;1-2-5-3-4-1/h1-2H,(H,5,6)(H,7,8);1-3H/b2-1-;.
What are the key properties of (Z)-but-2-enedioic acid;1,3-oxazole?
(Z)-but-2-enedioic acid;1,3-oxazole has a molecular weight of 185.13 g/mol, XLogP of 0.39, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-enedioic acid;1,3-oxazole is sourced from PubChem (CID 174408863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).