C7H7N3O2S — CID 134348804
(Z)-2-(1,3-thiazol-2-yl)but-2-enediamide (PubChem CID 134348804) has the molecular formula C7H7N3O2S and a molecular weight of 197.22 g/mol. Its IUPAC name is (Z)-2-(1,3-thiazol-2-yl)but-2-enediamide.
| Compound Name | (Z)-2-(1,3-thiazol-2-yl)but-2-enediamide |
|---|---|
| PubChem CID | 134348804 |
| Molecular Formula | C7H7N3O2S |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | (Z)-2-(1,3-thiazol-2-yl)but-2-enediamide |
| SMILES | NC(=O)/C=C(/C(N)=O)c1nccs1 |
| InChI | InChI=1S/C7H7N3O2S/c8-5(11)3-4(6(9)12)7-10-1-2-13-7/h1-3H,(H2,8,11)(H2,9,12)/b4-3- |
| InChIKey | BBBSNVQMVDRHIR-ARJAWSKDSA-N |
| XLogP | -0.50 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|