C5H5NO3S — CID 145074713
hydroxymethyl 1,3-thiazole-2-carboxylate (PubChem CID 145074713) has the molecular formula C5H5NO3S and a molecular weight of 159.17 g/mol. Its IUPAC name is hydroxymethyl 1,3-thiazole-2-carboxylate.
| Compound Name | hydroxymethyl 1,3-thiazole-2-carboxylate |
|---|---|
| PubChem CID | 145074713 |
| Molecular Formula | C5H5NO3S |
| Molecular Weight | 159.17 g/mol |
| Exact Mass | 159.00 |
| IUPAC Name | hydroxymethyl 1,3-thiazole-2-carboxylate |
| SMILES | O=C(OCO)c1nccs1 |
| InChI | InChI=1S/C5H5NO3S/c7-3-9-5(8)4-6-1-2-10-4/h1-2,7H,3H2 |
| InChIKey | POZOSUXGNNAFQM-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.17 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|