About [5-oxo-5-(1,3-thiazol-2-yl)pentyl] carbamate
[5-oxo-5-(1,3-thiazol-2-yl)pentyl] carbamate (PubChem CID 18788248) has the molecular formula C9H12N2O3S
and a molecular weight of 228.27 g/mol. Its IUPAC name is [5-oxo-5-(1,3-thiazol-2-yl)pentyl] carbamate.
Molecular Properties
| Compound Name | [5-oxo-5-(1,3-thiazol-2-yl)pentyl] carbamate |
| PubChem CID | 18788248 |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | [5-oxo-5-(1,3-thiazol-2-yl)pentyl] carbamate |
| SMILES | NC(=O)OCCCCC(=O)c1nccs1 |
| InChI | InChI=1S/C9H12N2O3S/c10-9(13)14-5-2-1-3-7(12)8-11-4-6-15-8/h4,6H,1-3,5H2,(H2,10,13) |
| InChIKey | VNGXWADUGAEDQQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [5-oxo-5-(1,3-thiazol-2-yl)pentyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-oxo-5-(1,3-thiazol-2-yl)pentyl] carbamate?
The IUPAC name of [5-oxo-5-(1,3-thiazol-2-yl)pentyl] carbamate (CID 18788248) is [5-oxo-5-(1,3-thiazol-2-yl)pentyl] carbamate.
What is the SMILES notation for [5-oxo-5-(1,3-thiazol-2-yl)pentyl] carbamate?
The canonical SMILES for [5-oxo-5-(1,3-thiazol-2-yl)pentyl] carbamate is NC(=O)OCCCCC(=O)c1nccs1.
What is the InChIKey of [5-oxo-5-(1,3-thiazol-2-yl)pentyl] carbamate?
The InChIKey is VNGXWADUGAEDQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3S/c10-9(13)14-5-2-1-3-7(12)8-11-4-6-15-8/h4,6H,1-3,5H2,(H2,10,13).
What are the key properties of [5-oxo-5-(1,3-thiazol-2-yl)pentyl] carbamate?
[5-oxo-5-(1,3-thiazol-2-yl)pentyl] carbamate has a molecular weight of 228.27 g/mol, XLogP of 1.59, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-oxo-5-(1,3-thiazol-2-yl)pentyl] carbamate is sourced from PubChem (CID 18788248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).