About [[2-oxo-2-(1,3-thiazol-2-yl)ethyl]amino]thiourea
[[2-oxo-2-(1,3-thiazol-2-yl)ethyl]amino]thiourea (PubChem CID 170262385) has the molecular formula C6H8N4OS2
and a molecular weight of 216.29 g/mol. Its IUPAC name is [[2-oxo-2-(1,3-thiazol-2-yl)ethyl]amino]thiourea.
Molecular Properties
| Compound Name | [[2-oxo-2-(1,3-thiazol-2-yl)ethyl]amino]thiourea |
| PubChem CID | 170262385 |
| Molecular Formula | C6H8N4OS2 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | [[2-oxo-2-(1,3-thiazol-2-yl)ethyl]amino]thiourea |
| SMILES | NC(=S)NNCC(=O)c1nccs1 |
| InChI | InChI=1S/C6H8N4OS2/c7-6(12)10-9-3-4(11)5-8-1-2-13-5/h1-2,9H,3H2,(H3,7,10,12) |
| InChIKey | FBZMDSIPMQRZKG-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [[2-oxo-2-(1,3-thiazol-2-yl)ethyl]amino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[2-oxo-2-(1,3-thiazol-2-yl)ethyl]amino]thiourea?
The IUPAC name of [[2-oxo-2-(1,3-thiazol-2-yl)ethyl]amino]thiourea (CID 170262385) is [[2-oxo-2-(1,3-thiazol-2-yl)ethyl]amino]thiourea.
What is the SMILES notation for [[2-oxo-2-(1,3-thiazol-2-yl)ethyl]amino]thiourea?
The canonical SMILES for [[2-oxo-2-(1,3-thiazol-2-yl)ethyl]amino]thiourea is NC(=S)NNCC(=O)c1nccs1.
What is the InChIKey of [[2-oxo-2-(1,3-thiazol-2-yl)ethyl]amino]thiourea?
The InChIKey is FBZMDSIPMQRZKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4OS2/c7-6(12)10-9-3-4(11)5-8-1-2-13-5/h1-2,9H,3H2,(H3,7,10,12).
What are the key properties of [[2-oxo-2-(1,3-thiazol-2-yl)ethyl]amino]thiourea?
[[2-oxo-2-(1,3-thiazol-2-yl)ethyl]amino]thiourea has a molecular weight of 216.29 g/mol, XLogP of -0.34, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [[2-oxo-2-(1,3-thiazol-2-yl)ethyl]amino]thiourea is sourced from PubChem (CID 170262385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).