C6H8N4OS2 — CID 170262385
[[2-oxo-2-(1,3-thiazol-2-yl)ethyl]amino]thiourea (PubChem CID 170262385) has the molecular formula C6H8N4OS2 and a molecular weight of 216.29 g/mol. Its IUPAC name is [[2-oxo-2-(1,3-thiazol-2-yl)ethyl]amino]thiourea.
| Compound Name | [[2-oxo-2-(1,3-thiazol-2-yl)ethyl]amino]thiourea |
|---|---|
| PubChem CID | 170262385 |
| Molecular Formula | C6H8N4OS2 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | [[2-oxo-2-(1,3-thiazol-2-yl)ethyl]amino]thiourea |
| SMILES | NC(=S)NNCC(=O)c1nccs1 |
| InChI | InChI=1S/C6H8N4OS2/c7-6(12)10-9-3-4(11)5-8-1-2-13-5/h1-2,9H,3H2,(H3,7,10,12) |
| InChIKey | FBZMDSIPMQRZKG-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|