C8H9ClN2O2S — CID 66568987
2-chloro-N-methyl-N-[2-oxo-2-(1,3-thiazol-2-yl)ethyl]acetamide (PubChem CID 66568987) has the molecular formula C8H9ClN2O2S and a molecular weight of 232.69 g/mol. Its IUPAC name is 2-chloro-N-methyl-N-[2-oxo-2-(1,3-thiazol-2-yl)ethyl]acetamide.
| Compound Name | 2-chloro-N-methyl-N-[2-oxo-2-(1,3-thiazol-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 66568987 |
| Molecular Formula | C8H9ClN2O2S |
| Molecular Weight | 232.69 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | 2-chloro-N-methyl-N-[2-oxo-2-(1,3-thiazol-2-yl)ethyl]acetamide |
| SMILES | CN(CC(=O)c1nccs1)C(=O)CCl |
| InChI | InChI=1S/C8H9ClN2O2S/c1-11(7(13)4-9)5-6(12)8-10-2-3-14-8/h2-3H,4-5H2,1H3 |
| InChIKey | DWHGRHUESATILB-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.69 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|