C7H8N2O4S2 — CID 150084977
ethoxycarbonylsulfanyl(1,3-thiazol-2-yl)carbamic acid (PubChem CID 150084977) has the molecular formula C7H8N2O4S2 and a molecular weight of 248.28 g/mol. Its IUPAC name is ethoxycarbonylsulfanyl(1,3-thiazol-2-yl)carbamic acid.
| Compound Name | ethoxycarbonylsulfanyl(1,3-thiazol-2-yl)carbamic acid |
|---|---|
| PubChem CID | 150084977 |
| Molecular Formula | C7H8N2O4S2 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | ethoxycarbonylsulfanyl(1,3-thiazol-2-yl)carbamic acid |
| SMILES | CCOC(=O)SN(C(=O)O)c1nccs1 |
| InChI | InChI=1S/C7H8N2O4S2/c1-2-13-7(12)15-9(6(10)11)5-8-3-4-14-5/h3-4H,2H2,1H3,(H,10,11) |
| InChIKey | DSAPFBDZCGCWTF-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|