C8H12N2O2S — CID 69435143
propyl(1,3-thiazol-2-ylmethyl)carbamic acid (PubChem CID 69435143) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is propyl(1,3-thiazol-2-ylmethyl)carbamic acid.
| Compound Name | propyl(1,3-thiazol-2-ylmethyl)carbamic acid |
|---|---|
| PubChem CID | 69435143 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | propyl(1,3-thiazol-2-ylmethyl)carbamic acid |
| SMILES | CCCN(Cc1nccs1)C(=O)O |
| InChI | InChI=1S/C8H12N2O2S/c1-2-4-10(8(11)12)6-7-9-3-5-13-7/h3,5H,2,4,6H2,1H3,(H,11,12) |
| InChIKey | ODOHTSLWGSORPA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |