propyl(1,3-thiazol-2-ylmethyl)carbamic acid

C8H12N2O2S — CID 69435143

IUPACpropyl(1,3-thiazol-2-ylmethyl)carbamic acid
SMILESCCCN(Cc1nccs1)C(=O)O
InChIInChI=1S/C8H12N2O2S/c1-2-4-10(8(11)12)6-7-9-3-5-13-7/h3,5H,2,4,6H2,1H3,(H,11,12)
InChIKeyODOHTSLWGSORPA-UHFFFAOYSA-N
MW200.26 g/mol
LogP2.03
Rot. Bonds4

About propyl(1,3-thiazol-2-ylmethyl)carbamic acid

propyl(1,3-thiazol-2-ylmethyl)carbamic acid (PubChem CID 69435143) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is propyl(1,3-thiazol-2-ylmethyl)carbamic acid.

Molecular Properties

Compound Namepropyl(1,3-thiazol-2-ylmethyl)carbamic acid
PubChem CID69435143
Molecular FormulaC8H12N2O2S
Molecular Weight200.26 g/mol
Exact Mass200.06
IUPAC Namepropyl(1,3-thiazol-2-ylmethyl)carbamic acid
SMILESCCCN(Cc1nccs1)C(=O)O
InChIInChI=1S/C8H12N2O2S/c1-2-4-10(8(11)12)6-7-9-3-5-13-7/h3,5H,2,4,6H2,1H3,(H,11,12)
InChIKeyODOHTSLWGSORPA-UHFFFAOYSA-N
XLogP2.03
TPSA53.43 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.26
LogP ≤ 52.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze propyl(1,3-thiazol-2-ylmethyl)carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of propyl(1,3-thiazol-2-ylmethyl)carbamic acid?
The IUPAC name of propyl(1,3-thiazol-2-ylmethyl)carbamic acid (CID 69435143) is propyl(1,3-thiazol-2-ylmethyl)carbamic acid.
What is the SMILES notation for propyl(1,3-thiazol-2-ylmethyl)carbamic acid?
The canonical SMILES for propyl(1,3-thiazol-2-ylmethyl)carbamic acid is CCCN(Cc1nccs1)C(=O)O.
What is the InChIKey of propyl(1,3-thiazol-2-ylmethyl)carbamic acid?
The InChIKey is ODOHTSLWGSORPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2S/c1-2-4-10(8(11)12)6-7-9-3-5-13-7/h3,5H,2,4,6H2,1H3,(H,11,12).
What are the key properties of propyl(1,3-thiazol-2-ylmethyl)carbamic acid?
propyl(1,3-thiazol-2-ylmethyl)carbamic acid has a molecular weight of 200.26 g/mol, XLogP of 2.03, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl(1,3-thiazol-2-ylmethyl)carbamic acid is sourced from PubChem (CID 69435143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).