C24H36N2O2S — CID 168720733
N-(2-hydroxyethyl)-9-(4-propylphenyl)-N-(1,3-thiazol-2-ylmethyl)nonanamide (PubChem CID 168720733) has the molecular formula C24H36N2O2S and a molecular weight of 416.63 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-9-(4-propylphenyl)-N-(1,3-thiazol-2-ylmethyl)nonanamide.
| Compound Name | N-(2-hydroxyethyl)-9-(4-propylphenyl)-N-(1,3-thiazol-2-ylmethyl)nonanamide |
|---|---|
| PubChem CID | 168720733 |
| Molecular Formula | C24H36N2O2S |
| Molecular Weight | 416.63 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | N-(2-hydroxyethyl)-9-(4-propylphenyl)-N-(1,3-thiazol-2-ylmethyl)nonanamide |
| SMILES | CCCc1ccc(CCCCCCCCC(=O)N(CCO)Cc2nccs2)cc1 |
| InChI | InChI=1S/C24H36N2O2S/c1-2-9-21-12-14-22(15-13-21)10-7-5-3-4-6-8-11-24(28)26(17-18-27)20-23-25-16-19-29-23/h12-16,19,27H,2-11,17-18,20H2,1H3 |
| InChIKey | VOSSLZOZJAGIGH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.63 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|