C11H12N2S2 — CID 175177928
N-benzyl-N-methylsulfanyl-1,3-thiazol-2-amine (PubChem CID 175177928) has the molecular formula C11H12N2S2 and a molecular weight of 236.37 g/mol. Its IUPAC name is N-benzyl-N-methylsulfanyl-1,3-thiazol-2-amine.
| Compound Name | N-benzyl-N-methylsulfanyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 175177928 |
| Molecular Formula | C11H12N2S2 |
| Molecular Weight | 236.37 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | N-benzyl-N-methylsulfanyl-1,3-thiazol-2-amine |
| SMILES | CSN(Cc1ccccc1)c1nccs1 |
| InChI | InChI=1S/C11H12N2S2/c1-14-13(11-12-7-8-15-11)9-10-5-3-2-4-6-10/h2-8H,9H2,1H3 |
| InChIKey | FCBNOEZONSTJFK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|