C13H15N3OS — CID 18134023
2-[benzyl(methyl)amino]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 18134023) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is 2-[benzyl(methyl)amino]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[benzyl(methyl)amino]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 18134023 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 2-[benzyl(methyl)amino]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | CN(CC(=O)Nc1nccs1)Cc1ccccc1 |
| InChI | InChI=1S/C13H15N3OS/c1-16(9-11-5-3-2-4-6-11)10-12(17)15-13-14-7-8-18-13/h2-8H,9-10H2,1H3,(H,14,15,17) |
| InChIKey | GANPTHZDEYHVPH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |