About N-benzyl-N-(1,3-thiazol-2-yl)formamide
N-benzyl-N-(1,3-thiazol-2-yl)formamide (PubChem CID 88636518) has the molecular formula C11H10N2OS
and a molecular weight of 218.28 g/mol. Its IUPAC name is N-benzyl-N-(1,3-thiazol-2-yl)formamide.
Molecular Properties
| Compound Name | N-benzyl-N-(1,3-thiazol-2-yl)formamide |
| PubChem CID | 88636518 |
| Molecular Formula | C11H10N2OS |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | N-benzyl-N-(1,3-thiazol-2-yl)formamide |
| SMILES | O=CN(Cc1ccccc1)c1nccs1 |
| InChI | InChI=1S/C11H10N2OS/c14-9-13(11-12-6-7-15-11)8-10-4-2-1-3-5-10/h1-7,9H,8H2 |
| InChIKey | FFIMEVVNTKYYTG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-N-(1,3-thiazol-2-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N-(1,3-thiazol-2-yl)formamide?
The IUPAC name of N-benzyl-N-(1,3-thiazol-2-yl)formamide (CID 88636518) is N-benzyl-N-(1,3-thiazol-2-yl)formamide.
What is the SMILES notation for N-benzyl-N-(1,3-thiazol-2-yl)formamide?
The canonical SMILES for N-benzyl-N-(1,3-thiazol-2-yl)formamide is O=CN(Cc1ccccc1)c1nccs1.
What is the InChIKey of N-benzyl-N-(1,3-thiazol-2-yl)formamide?
The InChIKey is FFIMEVVNTKYYTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2OS/c14-9-13(11-12-6-7-15-11)8-10-4-2-1-3-5-10/h1-7,9H,8H2.
What are the key properties of N-benzyl-N-(1,3-thiazol-2-yl)formamide?
N-benzyl-N-(1,3-thiazol-2-yl)formamide has a molecular weight of 218.28 g/mol, XLogP of 2.31, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N-(1,3-thiazol-2-yl)formamide is sourced from PubChem (CID 88636518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).