C10H7IN2O2S — CID 175420366
(2-iodophenyl)-(1,3-thiazol-2-yl)carbamic acid (PubChem CID 175420366) has the molecular formula C10H7IN2O2S and a molecular weight of 346.15 g/mol. Its IUPAC name is (2-iodophenyl)-(1,3-thiazol-2-yl)carbamic acid.
| Compound Name | (2-iodophenyl)-(1,3-thiazol-2-yl)carbamic acid |
|---|---|
| PubChem CID | 175420366 |
| Molecular Formula | C10H7IN2O2S |
| Molecular Weight | 346.15 g/mol |
| Exact Mass | 345.93 |
| IUPAC Name | (2-iodophenyl)-(1,3-thiazol-2-yl)carbamic acid |
| SMILES | O=C(O)N(c1nccs1)c1ccccc1I |
| InChI | InChI=1S/C10H7IN2O2S/c11-7-3-1-2-4-8(7)13(10(14)15)9-12-5-6-16-9/h1-6H,(H,14,15) |
| InChIKey | QQSCRUAQZXYGKI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.15 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|