About (2-iodophenyl)-(1,3-thiazol-2-yl)carbamic acid
(2-iodophenyl)-(1,3-thiazol-2-yl)carbamic acid (PubChem CID 175420366) has the molecular formula C10H7IN2O2S
and a molecular weight of 346.15 g/mol. Its IUPAC name is (2-iodophenyl)-(1,3-thiazol-2-yl)carbamic acid.
Molecular Properties
| Compound Name | (2-iodophenyl)-(1,3-thiazol-2-yl)carbamic acid |
| PubChem CID | 175420366 |
| Molecular Formula | C10H7IN2O2S |
| Molecular Weight | 346.15 g/mol |
| Exact Mass | 345.93 |
| IUPAC Name | (2-iodophenyl)-(1,3-thiazol-2-yl)carbamic acid |
| SMILES | O=C(O)N(c1nccs1)c1ccccc1I |
| InChI | InChI=1S/C10H7IN2O2S/c11-7-3-1-2-4-8(7)13(10(14)15)9-12-5-6-16-9/h1-6H,(H,14,15) |
| InChIKey | QQSCRUAQZXYGKI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.15 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2-iodophenyl)-(1,3-thiazol-2-yl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-iodophenyl)-(1,3-thiazol-2-yl)carbamic acid?
The IUPAC name of (2-iodophenyl)-(1,3-thiazol-2-yl)carbamic acid (CID 175420366) is (2-iodophenyl)-(1,3-thiazol-2-yl)carbamic acid.
What is the SMILES notation for (2-iodophenyl)-(1,3-thiazol-2-yl)carbamic acid?
The canonical SMILES for (2-iodophenyl)-(1,3-thiazol-2-yl)carbamic acid is O=C(O)N(c1nccs1)c1ccccc1I.
What is the InChIKey of (2-iodophenyl)-(1,3-thiazol-2-yl)carbamic acid?
The InChIKey is QQSCRUAQZXYGKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7IN2O2S/c11-7-3-1-2-4-8(7)13(10(14)15)9-12-5-6-16-9/h1-6H,(H,14,15).
What are the key properties of (2-iodophenyl)-(1,3-thiazol-2-yl)carbamic acid?
(2-iodophenyl)-(1,3-thiazol-2-yl)carbamic acid has a molecular weight of 346.15 g/mol, XLogP of 3.56, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-iodophenyl)-(1,3-thiazol-2-yl)carbamic acid is sourced from PubChem (CID 175420366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).