C16H13N3O3S2 — CID 118362143
1-[2-(benzenesulfonyl)phenyl]-1-(1,3-thiazol-2-yl)urea (PubChem CID 118362143) has the molecular formula C16H13N3O3S2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 1-[2-(benzenesulfonyl)phenyl]-1-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-[2-(benzenesulfonyl)phenyl]-1-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 118362143 |
| Molecular Formula | C16H13N3O3S2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | 1-[2-(benzenesulfonyl)phenyl]-1-(1,3-thiazol-2-yl)urea |
| SMILES | NC(=O)N(c1nccs1)c1ccccc1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H13N3O3S2/c17-15(20)19(16-18-10-11-23-16)13-8-4-5-9-14(13)24(21,22)12-6-2-1-3-7-12/h1-11H,(H2,17,20) |
| InChIKey | JEPAPZNLXXLEDR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |