About N-[(2R)-2-hydroxy-3,3-dimethylbutyl]-N-(1,3-thiazol-2-yl)benzenesulfonamide
N-[(2R)-2-hydroxy-3,3-dimethylbutyl]-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 124876257) has the molecular formula C15H20N2O3S2
and a molecular weight of 340.47 g/mol. Its IUPAC name is N-[(2R)-2-hydroxy-3,3-dimethylbutyl]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-[(2R)-2-hydroxy-3,3-dimethylbutyl]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| PubChem CID | 124876257 |
| Molecular Formula | C15H20N2O3S2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | N-[(2R)-2-hydroxy-3,3-dimethylbutyl]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | CC(C)(C)[C@@H](O)CN(c1nccs1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H20N2O3S2/c1-15(2,3)13(18)11-17(14-16-9-10-21-14)22(19,20)12-7-5-4-6-8-12/h4-10,13,18H,11H2,1-3H3/t13-/m0/s1 |
| InChIKey | SZKDRBQXLWXOKD-ZDUSSCGKSA-N |
| XLogP | 2.75 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(2R)-2-hydroxy-3,3-dimethylbutyl]-N-(1,3-thiazol-2-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R)-2-hydroxy-3,3-dimethylbutyl]-N-(1,3-thiazol-2-yl)benzenesulfonamide?
The IUPAC name of N-[(2R)-2-hydroxy-3,3-dimethylbutyl]-N-(1,3-thiazol-2-yl)benzenesulfonamide (CID 124876257) is N-[(2R)-2-hydroxy-3,3-dimethylbutyl]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
What is the SMILES notation for N-[(2R)-2-hydroxy-3,3-dimethylbutyl]-N-(1,3-thiazol-2-yl)benzenesulfonamide?
The canonical SMILES for N-[(2R)-2-hydroxy-3,3-dimethylbutyl]-N-(1,3-thiazol-2-yl)benzenesulfonamide is CC(C)(C)[C@@H](O)CN(c1nccs1)S(=O)(=O)c1ccccc1.
What is the InChIKey of N-[(2R)-2-hydroxy-3,3-dimethylbutyl]-N-(1,3-thiazol-2-yl)benzenesulfonamide?
The InChIKey is SZKDRBQXLWXOKD-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H20N2O3S2/c1-15(2,3)13(18)11-17(14-16-9-10-21-14)22(19,20)12-7-5-4-6-8-12/h4-10,13,18H,11H2,1-3H3/t13-/m0/s1.
What are the key properties of N-[(2R)-2-hydroxy-3,3-dimethylbutyl]-N-(1,3-thiazol-2-yl)benzenesulfonamide?
N-[(2R)-2-hydroxy-3,3-dimethylbutyl]-N-(1,3-thiazol-2-yl)benzenesulfonamide has a molecular weight of 340.47 g/mol, XLogP of 2.75, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R)-2-hydroxy-3,3-dimethylbutyl]-N-(1,3-thiazol-2-yl)benzenesulfonamide is sourced from PubChem (CID 124876257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).