C13H14N2O3S2 — CID 51108485
N-(2-oxobutyl)-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 51108485) has the molecular formula C13H14N2O3S2 and a molecular weight of 310.40 g/mol. Its IUPAC name is N-(2-oxobutyl)-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | N-(2-oxobutyl)-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 51108485 |
| Molecular Formula | C13H14N2O3S2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | N-(2-oxobutyl)-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | CCC(=O)CN(c1nccs1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H14N2O3S2/c1-2-11(16)10-15(13-14-8-9-19-13)20(17,18)12-6-4-3-5-7-12/h3-9H,2,10H2,1H3 |
| InChIKey | WGQKJGAQCVPOKE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |