C19H15N3O4S2 — CID 27805492
N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 27805492) has the molecular formula C19H15N3O4S2 and a molecular weight of 413.48 g/mol. Its IUPAC name is N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 27805492 |
| Molecular Formula | C19H15N3O4S2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | O=C1c2ccccc2C(=O)N1CCN(c1nccs1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H15N3O4S2/c23-17-15-8-4-5-9-16(15)18(24)21(17)11-12-22(19-20-10-13-27-19)28(25,26)14-6-2-1-3-7-14/h1-10,13H,11-12H2 |
| InChIKey | IBCLESNWQVHPNT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|