C18H17N3O3S2 — CID 17435397
2-[benzenesulfonyl(1,3-thiazol-2-yl)amino]-N-benzylacetamide (PubChem CID 17435397) has the molecular formula C18H17N3O3S2 and a molecular weight of 387.49 g/mol. Its IUPAC name is 2-[benzenesulfonyl(1,3-thiazol-2-yl)amino]-N-benzylacetamide.
| Compound Name | 2-[benzenesulfonyl(1,3-thiazol-2-yl)amino]-N-benzylacetamide |
|---|---|
| PubChem CID | 17435397 |
| Molecular Formula | C18H17N3O3S2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 2-[benzenesulfonyl(1,3-thiazol-2-yl)amino]-N-benzylacetamide |
| SMILES | O=C(CN(c1nccs1)S(=O)(=O)c1ccccc1)NCc1ccccc1 |
| InChI | InChI=1S/C18H17N3O3S2/c22-17(20-13-15-7-3-1-4-8-15)14-21(18-19-11-12-25-18)26(23,24)16-9-5-2-6-10-16/h1-12H,13-14H2,(H,20,22) |
| InChIKey | VTETWGFQQJOVOL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |