C13H11NO3S2 — CID 142933247
(E)-2-(4-methylsulfinylphenyl)-3-(1,3-thiazol-2-yl)prop-2-enoic acid (PubChem CID 142933247) has the molecular formula C13H11NO3S2 and a molecular weight of 293.37 g/mol. Its IUPAC name is (E)-2-(4-methylsulfinylphenyl)-3-(1,3-thiazol-2-yl)prop-2-enoic acid.
| Compound Name | (E)-2-(4-methylsulfinylphenyl)-3-(1,3-thiazol-2-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 142933247 |
| Molecular Formula | C13H11NO3S2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | (E)-2-(4-methylsulfinylphenyl)-3-(1,3-thiazol-2-yl)prop-2-enoic acid |
| SMILES | CS(=O)c1ccc(/C(=C\c2nccs2)C(=O)O)cc1 |
| InChI | InChI=1S/C13H11NO3S2/c1-19(17)10-4-2-9(3-5-10)11(13(15)16)8-12-14-6-7-18-12/h2-8H,1H3,(H,15,16)/b11-8+ |
| InChIKey | QMCZNRXQERSCHZ-DHZHZOJOSA-N |
| XLogP | 2.51 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|