About methyl 3-oxo-5-(1,3-thiazol-2-yl)pent-4-enoate
methyl 3-oxo-5-(1,3-thiazol-2-yl)pent-4-enoate (PubChem CID 161276516) has the molecular formula C18H18N2O6S2
and a molecular weight of 422.48 g/mol. Its IUPAC name is methyl 3-oxo-5-(1,3-thiazol-2-yl)pent-4-enoate.
Molecular Properties
| Compound Name | methyl 3-oxo-5-(1,3-thiazol-2-yl)pent-4-enoate |
| PubChem CID | 161276516 |
| Molecular Formula | C18H18N2O6S2 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | methyl 3-oxo-5-(1,3-thiazol-2-yl)pent-4-enoate |
| SMILES | COC(=O)CC(=O)C=Cc1nccs1.COC(=O)CC(=O)C=Cc1nccs1 |
| InChI | InChI=1S/2C9H9NO3S/c2*1-13-9(12)6-7(11)2-3-8-10-4-5-14-8/h2*2-5H,6H2,1H3 |
| InChIKey | VEMWBMHIBRJLSR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 112.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-oxo-5-(1,3-thiazol-2-yl)pent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-oxo-5-(1,3-thiazol-2-yl)pent-4-enoate?
The IUPAC name of methyl 3-oxo-5-(1,3-thiazol-2-yl)pent-4-enoate (CID 161276516) is methyl 3-oxo-5-(1,3-thiazol-2-yl)pent-4-enoate.
What is the SMILES notation for methyl 3-oxo-5-(1,3-thiazol-2-yl)pent-4-enoate?
The canonical SMILES for methyl 3-oxo-5-(1,3-thiazol-2-yl)pent-4-enoate is COC(=O)CC(=O)C=Cc1nccs1.COC(=O)CC(=O)C=Cc1nccs1.
What is the InChIKey of methyl 3-oxo-5-(1,3-thiazol-2-yl)pent-4-enoate?
The InChIKey is VEMWBMHIBRJLSR-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H9NO3S/c2*1-13-9(12)6-7(11)2-3-8-10-4-5-14-8/h2*2-5H,6H2,1H3.
What are the key properties of methyl 3-oxo-5-(1,3-thiazol-2-yl)pent-4-enoate?
methyl 3-oxo-5-(1,3-thiazol-2-yl)pent-4-enoate has a molecular weight of 422.48 g/mol, XLogP of 2.58, 8 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-oxo-5-(1,3-thiazol-2-yl)pent-4-enoate is sourced from PubChem (CID 161276516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).