C12H17N3OS — CID 71877104
1-(2,4-dimethylpiperazin-1-yl)-3-(1,3-thiazol-2-yl)prop-2-en-1-one (PubChem CID 71877104) has the molecular formula C12H17N3OS and a molecular weight of 251.35 g/mol. Its IUPAC name is 1-(2,4-dimethylpiperazin-1-yl)-3-(1,3-thiazol-2-yl)prop-2-en-1-one.
| Compound Name | 1-(2,4-dimethylpiperazin-1-yl)-3-(1,3-thiazol-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 71877104 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 1-(2,4-dimethylpiperazin-1-yl)-3-(1,3-thiazol-2-yl)prop-2-en-1-one |
| SMILES | CC1CN(C)CCN1C(=O)C=Cc1nccs1 |
| InChI | InChI=1S/C12H17N3OS/c1-10-9-14(2)6-7-15(10)12(16)4-3-11-13-5-8-17-11/h3-5,8,10H,6-7,9H2,1-2H3 |
| InChIKey | YKZFLZQIXRUOKJ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|