C17H17N7OS — CID 94657819
(Z)-1-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]-3-(1,3-thiazol-2-yl)prop-2-en-1-one (PubChem CID 94657819) has the molecular formula C17H17N7OS and a molecular weight of 367.44 g/mol. Its IUPAC name is (Z)-1-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]-3-(1,3-thiazol-2-yl)prop-2-en-1-one.
| Compound Name | (Z)-1-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]-3-(1,3-thiazol-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 94657819 |
| Molecular Formula | C17H17N7OS |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | (Z)-1-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]-3-(1,3-thiazol-2-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C\c1nccs1)N1CCN(c2nnnn2-c2ccccc2)CC1 |
| InChI | InChI=1S/C17H17N7OS/c25-16(7-6-15-18-8-13-26-15)22-9-11-23(12-10-22)17-19-20-21-24(17)14-4-2-1-3-5-14/h1-8,13H,9-12H2/b7-6- |
| InChIKey | KVOMQSZUOAGOMS-SREVYHEPSA-N |
| XLogP | 1.48 |
| TPSA | 80.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|