C7H10N2S — CID 90120326
(E)-N,N-dimethyl-2-(1,3-thiazol-2-yl)ethenamine (PubChem CID 90120326) has the molecular formula C7H10N2S and a molecular weight of 154.24 g/mol. Its IUPAC name is (E)-N,N-dimethyl-2-(1,3-thiazol-2-yl)ethenamine.
| Compound Name | (E)-N,N-dimethyl-2-(1,3-thiazol-2-yl)ethenamine |
|---|---|
| PubChem CID | 90120326 |
| Molecular Formula | C7H10N2S |
| Molecular Weight | 154.24 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | (E)-N,N-dimethyl-2-(1,3-thiazol-2-yl)ethenamine |
| SMILES | CN(C)/C=C/c1nccs1 |
| InChI | InChI=1S/C7H10N2S/c1-9(2)5-3-7-8-4-6-10-7/h3-6H,1-2H3/b5-3+ |
| InChIKey | KQJLNFUOWDHIIS-HWKANZROSA-N |
| XLogP | 1.68 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |