C12H11NOS — CID 14090876
2-[(E)-2-(4-methoxyphenyl)ethenyl]-1,3-thiazole (PubChem CID 14090876) has the molecular formula C12H11NOS and a molecular weight of 217.29 g/mol. Its IUPAC name is 2-[(E)-2-(4-methoxyphenyl)ethenyl]-1,3-thiazole.
| Compound Name | 2-[(E)-2-(4-methoxyphenyl)ethenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 14090876 |
| Molecular Formula | C12H11NOS |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 2-[(E)-2-(4-methoxyphenyl)ethenyl]-1,3-thiazole |
| SMILES | COc1ccc(/C=C/c2nccs2)cc1 |
| InChI | InChI=1S/C12H11NOS/c1-14-11-5-2-10(3-6-11)4-7-12-13-8-9-15-12/h2-9H,1H3/b7-4+ |
| InChIKey | SADYIDNQRINMAV-QPJJXVBHSA-N |
| XLogP | 3.32 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |