C19H17NO7 — CID 135442659
methyl 2-[[3-[(E)-3-(4-hydroxy-6-methyl-2-oxopyran-3-yl)-3-oxoprop-1-enyl]benzoyl]amino]acetate (PubChem CID 135442659) has the molecular formula C19H17NO7 and a molecular weight of 371.35 g/mol. Its IUPAC name is methyl 2-[[3-[(E)-3-(4-hydroxy-6-methyl-2-oxopyran-3-yl)-3-oxoprop-1-enyl]benzoyl]amino]acetate.
| Compound Name | methyl 2-[[3-[(E)-3-(4-hydroxy-6-methyl-2-oxopyran-3-yl)-3-oxoprop-1-enyl]benzoyl]amino]acetate |
|---|---|
| PubChem CID | 135442659 |
| Molecular Formula | C19H17NO7 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | methyl 2-[[3-[(E)-3-(4-hydroxy-6-methyl-2-oxopyran-3-yl)-3-oxoprop-1-enyl]benzoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1cccc(/C=C/C(=O)c2c(O)cc(C)oc2=O)c1 |
| InChI | InChI=1S/C19H17NO7/c1-11-8-15(22)17(19(25)27-11)14(21)7-6-12-4-3-5-13(9-12)18(24)20-10-16(23)26-2/h3-9,22H,10H2,1-2H3,(H,20,24)/b7-6+ |
| InChIKey | UVUWAVJKYQUPJU-VOTSOKGWSA-N |
| XLogP | 1.45 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|