C24H26N2O6 — CID 68678457
methyl 2-[[3-[(E)-3-(6-methyl-2-oxo-4-piperidin-1-ylpyran-3-yl)-3-oxoprop-1-enyl]benzoyl]amino]acetate (PubChem CID 68678457) has the molecular formula C24H26N2O6 and a molecular weight of 438.48 g/mol. Its IUPAC name is methyl 2-[[3-[(E)-3-(6-methyl-2-oxo-4-piperidin-1-ylpyran-3-yl)-3-oxoprop-1-enyl]benzoyl]amino]acetate.
| Compound Name | methyl 2-[[3-[(E)-3-(6-methyl-2-oxo-4-piperidin-1-ylpyran-3-yl)-3-oxoprop-1-enyl]benzoyl]amino]acetate |
|---|---|
| PubChem CID | 68678457 |
| Molecular Formula | C24H26N2O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | methyl 2-[[3-[(E)-3-(6-methyl-2-oxo-4-piperidin-1-ylpyran-3-yl)-3-oxoprop-1-enyl]benzoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1cccc(/C=C/C(=O)c2c(N3CCCCC3)cc(C)oc2=O)c1 |
| InChI | InChI=1S/C24H26N2O6/c1-16-13-19(26-11-4-3-5-12-26)22(24(30)32-16)20(27)10-9-17-7-6-8-18(14-17)23(29)25-15-21(28)31-2/h6-10,13-14H,3-5,11-12,15H2,1-2H3,(H,25,29)/b10-9+ |
| InChIKey | AJKPRLSDNAURFN-MDZDMXLPSA-N |
| XLogP | 2.74 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|