C42H42N2O6 — CID 139039273
1-nitro-4-[(1E,3E,5E)-6-(4-propoxyphenyl)hexa-1,3,5-trienyl]benzene (PubChem CID 139039273) has the molecular formula C42H42N2O6 and a molecular weight of 670.81 g/mol. Its IUPAC name is 1-nitro-4-[(1E,3E,5E)-6-(4-propoxyphenyl)hexa-1,3,5-trienyl]benzene.
| Compound Name | 1-nitro-4-[(1E,3E,5E)-6-(4-propoxyphenyl)hexa-1,3,5-trienyl]benzene |
|---|---|
| PubChem CID | 139039273 |
| Molecular Formula | C42H42N2O6 |
| Molecular Weight | 670.81 g/mol |
| Exact Mass | 670.30 |
| IUPAC Name | 1-nitro-4-[(1E,3E,5E)-6-(4-propoxyphenyl)hexa-1,3,5-trienyl]benzene |
| SMILES | CCCOc1ccc(/C=C/C=C/C=C/c2ccc([N+](=O)[O-])cc2)cc1.CCCOc1ccc(/C=C/C=C/C=C/c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/2C21H21NO3/c2*1-2-17-25-21-15-11-19(12-16-21)8-6-4-3-5-7-18-9-13-20(14-10-18)22(23)24/h2*3-16H,2,17H2,1H3/b2*4-3+,7-5+,8-6+ |
| InChIKey | WZXYVTGVOXYWLL-LLFMRZDUSA-N |
| XLogP | 11.33 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.81 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|