About diethyl (3-nitrophenyl) phosphate
diethyl (3-nitrophenyl) phosphate (PubChem CID 521179) has the molecular formula C10H14NO6P
and a molecular weight of 275.20 g/mol. Its IUPAC name is diethyl (3-nitrophenyl) phosphate.
Molecular Properties
| Compound Name | diethyl (3-nitrophenyl) phosphate |
| PubChem CID | 521179 |
| Molecular Formula | C10H14NO6P |
| Molecular Weight | 275.20 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | diethyl (3-nitrophenyl) phosphate |
| SMILES | CCOP(=O)(OCC)Oc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H14NO6P/c1-3-15-18(14,16-4-2)17-10-7-5-6-9(8-10)11(12)13/h5-8H,3-4H2,1-2H3 |
| InChIKey | VXPBWHFHOQMMHT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.20 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diethyl (3-nitrophenyl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl (3-nitrophenyl) phosphate?
The IUPAC name of diethyl (3-nitrophenyl) phosphate (CID 521179) is diethyl (3-nitrophenyl) phosphate.
What is the SMILES notation for diethyl (3-nitrophenyl) phosphate?
The canonical SMILES for diethyl (3-nitrophenyl) phosphate is CCOP(=O)(OCC)Oc1cccc([N+](=O)[O-])c1.
What is the InChIKey of diethyl (3-nitrophenyl) phosphate?
The InChIKey is VXPBWHFHOQMMHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14NO6P/c1-3-15-18(14,16-4-2)17-10-7-5-6-9(8-10)11(12)13/h5-8H,3-4H2,1-2H3.
What are the key properties of diethyl (3-nitrophenyl) phosphate?
diethyl (3-nitrophenyl) phosphate has a molecular weight of 275.20 g/mol, XLogP of 3.15, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl (3-nitrophenyl) phosphate is sourced from PubChem (CID 521179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).