C16H18N2O5Si — CID 91737520
benzyl-[(3,5-dinitrophenyl)methoxy]-dimethylsilane (PubChem CID 91737520) has the molecular formula C16H18N2O5Si and a molecular weight of 346.42 g/mol. Its IUPAC name is benzyl-[(3,5-dinitrophenyl)methoxy]-dimethylsilane.
| Compound Name | benzyl-[(3,5-dinitrophenyl)methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 91737520 |
| Molecular Formula | C16H18N2O5Si |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | benzyl-[(3,5-dinitrophenyl)methoxy]-dimethylsilane |
| SMILES | C[Si](C)(Cc1ccccc1)OCc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H18N2O5Si/c1-24(2,12-13-6-4-3-5-7-13)23-11-14-8-15(17(19)20)10-16(9-14)18(21)22/h3-10H,11-12H2,1-2H3 |
| InChIKey | HBTOAUWRLJJLSL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|