C23H36O2Si2 — CID 69305506
benzyl-[3-[benzyl(dimethyl)silyl]oxy-2,2-dimethylpropoxy]-dimethylsilane (PubChem CID 69305506) has the molecular formula C23H36O2Si2 and a molecular weight of 400.71 g/mol. Its IUPAC name is benzyl-[3-[benzyl(dimethyl)silyl]oxy-2,2-dimethylpropoxy]-dimethylsilane.
| Compound Name | benzyl-[3-[benzyl(dimethyl)silyl]oxy-2,2-dimethylpropoxy]-dimethylsilane |
|---|---|
| PubChem CID | 69305506 |
| Molecular Formula | C23H36O2Si2 |
| Molecular Weight | 400.71 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | benzyl-[3-[benzyl(dimethyl)silyl]oxy-2,2-dimethylpropoxy]-dimethylsilane |
| SMILES | CC(C)(CO[Si](C)(C)Cc1ccccc1)CO[Si](C)(C)Cc1ccccc1 |
| InChI | InChI=1S/C23H36O2Si2/c1-23(2,19-24-26(3,4)17-21-13-9-7-10-14-21)20-25-27(5,6)18-22-15-11-8-12-16-22/h7-16H,17-20H2,1-6H3 |
| InChIKey | OOVIUSXKWGGEQB-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.71 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|