C16H28OSi — CID 91697275
benzyl-(2,4-dimethylpentan-3-yloxy)-dimethylsilane (PubChem CID 91697275) has the molecular formula C16H28OSi and a molecular weight of 264.49 g/mol. Its IUPAC name is benzyl-(2,4-dimethylpentan-3-yloxy)-dimethylsilane.
| Compound Name | benzyl-(2,4-dimethylpentan-3-yloxy)-dimethylsilane |
|---|---|
| PubChem CID | 91697275 |
| Molecular Formula | C16H28OSi |
| Molecular Weight | 264.49 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | benzyl-(2,4-dimethylpentan-3-yloxy)-dimethylsilane |
| SMILES | CC(C)C(O[Si](C)(C)Cc1ccccc1)C(C)C |
| InChI | InChI=1S/C16H28OSi/c1-13(2)16(14(3)4)17-18(5,6)12-15-10-8-7-9-11-15/h7-11,13-14,16H,12H2,1-6H3 |
| InChIKey | FUVFMIRVQTXCGB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|