C14H25NO2SSi — CID 162684133
tert-butyl-[[2-(1-ethoxyethenyl)-1,3-thiazol-5-yl]methoxy]-dimethylsilane (PubChem CID 162684133) has the molecular formula C14H25NO2SSi and a molecular weight of 299.51 g/mol. Its IUPAC name is tert-butyl-[[2-(1-ethoxyethenyl)-1,3-thiazol-5-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[2-(1-ethoxyethenyl)-1,3-thiazol-5-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 162684133 |
| Molecular Formula | C14H25NO2SSi |
| Molecular Weight | 299.51 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | tert-butyl-[[2-(1-ethoxyethenyl)-1,3-thiazol-5-yl]methoxy]-dimethylsilane |
| SMILES | C=C(OCC)c1ncc(CO[Si](C)(C)C(C)(C)C)s1 |
| InChI | InChI=1S/C14H25NO2SSi/c1-8-16-11(2)13-15-9-12(18-13)10-17-19(6,7)14(3,4)5/h9H,2,8,10H2,1,3-7H3 |
| InChIKey | CSJMMUYPPQYFBN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|