C15H13N3O3S — CID 163215792
N-butyl-4,9-dioxo-[1,3]thiazolo[5,4-g]isoquinoline-2-carboxamide (PubChem CID 163215792) has the molecular formula C15H13N3O3S and a molecular weight of 315.35 g/mol. Its IUPAC name is N-butyl-4,9-dioxo-[1,3]thiazolo[5,4-g]isoquinoline-2-carboxamide.
| Compound Name | N-butyl-4,9-dioxo-[1,3]thiazolo[5,4-g]isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 163215792 |
| Molecular Formula | C15H13N3O3S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | N-butyl-4,9-dioxo-[1,3]thiazolo[5,4-g]isoquinoline-2-carboxamide |
| SMILES | CCCCNC(=O)c1nc2c(s1)C(=O)c1ccncc1C2=O |
| InChI | InChI=1S/C15H13N3O3S/c1-2-3-5-17-14(21)15-18-10-11(19)9-7-16-6-4-8(9)12(20)13(10)22-15/h4,6-7H,2-3,5H2,1H3,(H,17,21) |
| InChIKey | LTCOYHMHIBOKGK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|