C19H22N4O3 — CID 145367268
N-butyl-4-[(5,8-dioxoquinazolin-6-yl)amino]benzamide;molecular hydrogen (PubChem CID 145367268) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-butyl-4-[(5,8-dioxoquinazolin-6-yl)amino]benzamide;molecular hydrogen.
| Compound Name | N-butyl-4-[(5,8-dioxoquinazolin-6-yl)amino]benzamide;molecular hydrogen |
|---|---|
| PubChem CID | 145367268 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-butyl-4-[(5,8-dioxoquinazolin-6-yl)amino]benzamide;molecular hydrogen |
| SMILES | CCCCNC(=O)c1ccc(NC2=CC(=O)c3ncncc3C2=O)cc1.[H][H].[H][H] |
| InChI | InChI=1S/C19H18N4O3.2H2/c1-2-3-8-21-19(26)12-4-6-13(7-5-12)23-15-9-16(24)17-14(18(15)25)10-20-11-22-17;;/h4-7,9-11,23H,2-3,8H2,1H3,(H,21,26);2*1H |
| InChIKey | JFVXVUBDJSFMJS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|