C16H9NO4S — CID 21184412
2-(furan-2-yl)-7-methoxybenzo[f][1,3]benzothiazole-4,9-dione (PubChem CID 21184412) has the molecular formula C16H9NO4S and a molecular weight of 311.32 g/mol. Its IUPAC name is 2-(furan-2-yl)-7-methoxybenzo[f][1,3]benzothiazole-4,9-dione.
| Compound Name | 2-(furan-2-yl)-7-methoxybenzo[f][1,3]benzothiazole-4,9-dione |
|---|---|
| PubChem CID | 21184412 |
| Molecular Formula | C16H9NO4S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 2-(furan-2-yl)-7-methoxybenzo[f][1,3]benzothiazole-4,9-dione |
| SMILES | COc1ccc2c(c1)C(=O)c1sc(-c3ccco3)nc1C2=O |
| InChI | InChI=1S/C16H9NO4S/c1-20-8-4-5-9-10(7-8)14(19)15-12(13(9)18)17-16(22-15)11-3-2-6-21-11/h2-7H,1H3 |
| InChIKey | JTZQOZNCHKHLLN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|