C17H17N3O3S — CID 91025052
2-(furan-2-yl)-5-(2-pyrrolidin-1-ylethylimino)-1,3-benzothiazole-4,7-dione (PubChem CID 91025052) has the molecular formula C17H17N3O3S and a molecular weight of 343.41 g/mol. Its IUPAC name is 2-(furan-2-yl)-5-(2-pyrrolidin-1-ylethylimino)-1,3-benzothiazole-4,7-dione.
| Compound Name | 2-(furan-2-yl)-5-(2-pyrrolidin-1-ylethylimino)-1,3-benzothiazole-4,7-dione |
|---|---|
| PubChem CID | 91025052 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 2-(furan-2-yl)-5-(2-pyrrolidin-1-ylethylimino)-1,3-benzothiazole-4,7-dione |
| SMILES | O=C1/C(=N/CCN2CCCC2)CC(=O)c2sc(-c3ccco3)nc21 |
| InChI | InChI=1S/C17H17N3O3S/c21-12-10-11(18-5-8-20-6-1-2-7-20)15(22)14-16(12)24-17(19-14)13-4-3-9-23-13/h3-4,9H,1-2,5-8,10H2/b18-11+ |
| InChIKey | DLQNSDWYYXNTHR-WOJGMQOQSA-N |
| XLogP | 2.71 |
| TPSA | 75.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|