C23H22N4O4 — CID 67566382
2,3-bis(furan-2-yl)-6-(3-pyrrolidin-1-ylpropylamino)quinoxaline-5,8-dione (PubChem CID 67566382) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is 2,3-bis(furan-2-yl)-6-(3-pyrrolidin-1-ylpropylamino)quinoxaline-5,8-dione.
| Compound Name | 2,3-bis(furan-2-yl)-6-(3-pyrrolidin-1-ylpropylamino)quinoxaline-5,8-dione |
|---|---|
| PubChem CID | 67566382 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 2,3-bis(furan-2-yl)-6-(3-pyrrolidin-1-ylpropylamino)quinoxaline-5,8-dione |
| SMILES | O=C1C=C(NCCCN2CCCC2)C(=O)c2nc(-c3ccco3)c(-c3ccco3)nc21 |
| InChI | InChI=1S/C23H22N4O4/c28-16-14-15(24-8-5-11-27-9-1-2-10-27)23(29)22-19(16)25-20(17-6-3-12-30-17)21(26-22)18-7-4-13-31-18/h3-4,6-7,12-14,24H,1-2,5,8-11H2 |
| InChIKey | ADISJSBQTKLAIL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 101.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|