C23H22N4O4 — CID 67566890
6-[(1-ethylpyrrolidin-2-yl)methylamino]-2,3-bis(furan-2-yl)quinoxaline-5,8-dione (PubChem CID 67566890) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is 6-[(1-ethylpyrrolidin-2-yl)methylamino]-2,3-bis(furan-2-yl)quinoxaline-5,8-dione.
| Compound Name | 6-[(1-ethylpyrrolidin-2-yl)methylamino]-2,3-bis(furan-2-yl)quinoxaline-5,8-dione |
|---|---|
| PubChem CID | 67566890 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 6-[(1-ethylpyrrolidin-2-yl)methylamino]-2,3-bis(furan-2-yl)quinoxaline-5,8-dione |
| SMILES | CCN1CCCC1CNC1=CC(=O)c2nc(-c3ccco3)c(-c3ccco3)nc2C1=O |
| InChI | InChI=1S/C23H22N4O4/c1-2-27-9-3-6-14(27)13-24-15-12-16(28)19-22(23(15)29)26-21(18-8-5-11-31-18)20(25-19)17-7-4-10-30-17/h4-5,7-8,10-12,14,24H,2-3,6,9,13H2,1H3 |
| InChIKey | NRRDIAMDQDOWAF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 101.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|